cas: 6326-79-0 — see every product listed under this CAS number, including other names
6-Bromoisatin, 95% (CAS 6326-79-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 100g, 500g, 1kg. Offered by: Thermo Scientific (Acros), Fluorochem.
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 455510050 |
| cas | 6326-79-0 |
| size | 5g |
| availability | availability |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 309.14 Pln | |
| Thermo Scientific (Acros) | 25g | 1082.43 Pln | |
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 148.92 Pln | |
| Fluorochem | 25g | 242.64 Pln | |
| Fluorochem | 100g | 716.43 Pln | |
| Fluorochem | 500g | 2361.69 Pln | |
| Fluorochem | 1kg | 3798.68 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
6-bromo-1H-indole-2,3-dione (CAS 6326-79-0) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 6-bromo-1H-indole-2,3-dione. InChIKey: HVPQMLZLINVIHW-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 6-bromo-1H-indole-2,3-dione |
| InChIKey | HVPQMLZLINVIHW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=O)C2=O |
Computed by PubChem (NCBI)