CAS 6326-79-0 appears in our catalog under these names: 6-Bromo Isatin, 6–Bromoisatin, 6-Bromoisatin, 6-Bromoisatin, 95%, 6-Bromoisatin, >97.0%(GC)(T). Offered by: TRC, GLPBio, Biosynth, Thermo Scientific (Acros), TCI. Available pack sizes: 5g, 100g, 25g, 10g, 50g, 1000g, 1g, 500g.
6-bromo-1H-indole-2,3-dione (CAS 6326-79-0) is a chemical compound with the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. IUPAC name: 6-bromo-1H-indole-2,3-dione. InChIKey: HVPQMLZLINVIHW-UHFFFAOYSA-N.
| Molecular formula | C8H4BrNO2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 6-bromo-1H-indole-2,3-dione |
| InChIKey | HVPQMLZLINVIHW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC(=O)C2=O |
Computed by PubChem (NCBI)