Products 912934-77-1
CAS 912934-77-1 appears in our catalog under these names: 6–Bromopyridine–2–sulfonyl chloride, 6-Bromopyridine-2-sulfonyl chloride, 6-Bromopyridine-2-sulfonyl chloride 95%, 6-Bromo-2-pyridinesulfonyl chloride, 95%+, 95%+, 6-Bromopyridine-2-sulfonyl chloride, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 10g, 1g, 5g.
6-bromopyridine-2-sulfonyl chloride (CAS 912934-77-1) is a chemical compound with the molecular formula C5H3BrClNO2S and a molecular weight of 256.51 g/mol. IUPAC name: 6-bromopyridine-2-sulfonyl chloride. InChIKey: UGUYJEZIJYXIDU-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO2S |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 6-bromopyridine-2-sulfonyl chloride |
| InChIKey | UGUYJEZIJYXIDU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)