CAS 65001-21-0 appears in our catalog under these names: 5-Bromopyridine-3-sulfonyl chloride, 95%, 5–Bromopyridine–3–sulfonyl chloride, 5-Bromopyridine-3-sulfonyl chloride, 97% , 5-Bromopyridine-3-sulfonyl chloride 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 25g.
5-bromopyridine-3-sulfonyl chloride (CAS 65001-21-0) is a chemical compound with the molecular formula C5H3BrClNO2S and a molecular weight of 256.51 g/mol. IUPAC name: 5-bromopyridine-3-sulfonyl chloride. InChIKey: AVILRJQPDYPXFQ-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO2S |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 5-bromopyridine-3-sulfonyl chloride |
| InChIKey | AVILRJQPDYPXFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)