CAS 1060811-61-1 is the registry number for 2-Bromo-pyridine-4-sulfonyl Chloride. Offered by: TRC. Available pack sizes: 1g.
2-bromopyridine-4-sulfonyl chloride (CAS 1060811-61-1) is a chemical compound with the molecular formula C5H3BrClNO2S and a molecular weight of 256.51 g/mol. IUPAC name: 2-bromopyridine-4-sulfonyl chloride. InChIKey: ISYAMOKUNSIOHJ-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO2S |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 2-bromopyridine-4-sulfonyl chloride |
| InChIKey | ISYAMOKUNSIOHJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1S(=O)(=O)Cl)Br |
Computed by PubChem (NCBI)