Products 1060811-59-7
CAS 1060811-59-7 appears in our catalog under these names: 2-bromopyridine-3-sulfonyl chloride, 95%, 2-Bromopyridine-3-sulfonyl chloride, 98+%, 2-Bromopyridine-3-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 0,5g, 50mg.
2-bromopyridine-3-sulfonyl chloride (CAS 1060811-59-7) is a chemical compound with the molecular formula C5H3BrClNO2S and a molecular weight of 256.51 g/mol. IUPAC name: 2-bromopyridine-3-sulfonyl chloride. InChIKey: XJPBDTIFSUZVAK-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO2S |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 2-bromopyridine-3-sulfonyl chloride |
| InChIKey | XJPBDTIFSUZVAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)