CAS 1060808-87-8 appears in our catalog under these names: 4-Bromopyridine-2-sulfonyl chloride, 95%, 4-Bromopyridine-2-sulfonyl chloride 98%, 4-BroMopyridine-2-sulfonyl chloride, 98%, 98%, 4-Bromopyridine-2-sulfonyl chloride, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
4-bromopyridine-2-sulfonyl chloride (CAS 1060808-87-8) is a chemical compound with the molecular formula C5H3BrClNO2S and a molecular weight of 256.51 g/mol. IUPAC name: 4-bromopyridine-2-sulfonyl chloride. InChIKey: IHFLWMCWRPGYNP-UHFFFAOYSA-N.
| Molecular formula | C5H3BrClNO2S |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 4-bromopyridine-2-sulfonyl chloride |
| InChIKey | IHFLWMCWRPGYNP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)