cas: 6848-16-4 — see every product listed under this CAS number, including other names
6-Chloro-1,2-dihydro-2,2,4-trimethylquinoline, 98%, 98% (CAS 6848-16-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117JNE-100mg |
| cas | 6848-16-4 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 904.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
6-chloro-2,2,4-trimethyl-1H-quinoline (CAS 6848-16-4) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 6-chloro-2,2,4-trimethyl-1H-quinoline. InChIKey: XQGISKQNLSPHNQ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 6-chloro-2,2,4-trimethyl-1H-quinoline |
| InChIKey | XQGISKQNLSPHNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)Cl)(C)C |
Computed by PubChem (NCBI)