CAS 6848-16-4 appears in our catalog under these names: 6-Chloro-1,2-dihydro-2,2,4-trimethylquinoline, 95%, 6-Chloro-2,2,4-trimethyl-1,2-dihydroquinoline, 95+%, 6-Chloro-1,2-dihydro-2,2,4-trimethylquinoline, 98%, 98%, 6-Chloro-2,2,4-trimethyl-1,2-dihydroquinoline, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
6-chloro-2,2,4-trimethyl-1H-quinoline (CAS 6848-16-4) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 6-chloro-2,2,4-trimethyl-1H-quinoline. InChIKey: XQGISKQNLSPHNQ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 6-chloro-2,2,4-trimethyl-1H-quinoline |
| InChIKey | XQGISKQNLSPHNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(NC2=C1C=C(C=C2)Cl)(C)C |
Computed by PubChem (NCBI)