CAS 82572-04-1 appears in our catalog under these names: (1R)-1-(1-Naphthyl)ethylamine Hydrochloride, (R)-(+)-1-(1-Naphthyl)ethylamine hydrochloride, 98%, (R)-1-(Naphthalen-1-yl)ethanamine hydrochloride, 98%, (R)-1-(Naphthalen-1-yl)ethanamine (hydrochloride), 99.95%, (R)-1-(Naphthalen-1-yl)ethanamine hydrochloride, 98%, 98%. Offered by: Mikromol, Fluorochem, Combi-blocks, MedChemExpress, Ambeed. Available pack sizes: 25mg, 250mg, 1g, 5g, 10g, 25g, 10 g, 5 g.
(1R)-1-naphthalen-1-ylethanamine;hydrochloride (CAS 82572-04-1) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1R)-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: ZTNKTVBJMXQOBQ-SBSPUUFOSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1R)-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | ZTNKTVBJMXQOBQ-SBSPUUFOSA-N |
| SMILES | C[C@H](C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)