CAS 146304-90-7 is the registry number for 1-(Chloromethyl)-3,3-dimethyl-3,4-dihydroisoquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
1-(chloromethyl)-3,3-dimethyl-4H-isoquinoline (CAS 146304-90-7) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 1-(chloromethyl)-3,3-dimethyl-4H-isoquinoline. InChIKey: DHSVZFOMFDMCRI-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 1-(chloromethyl)-3,3-dimethyl-4H-isoquinoline |
| InChIKey | DHSVZFOMFDMCRI-UHFFFAOYSA-N |
| SMILES | CC1(CC2=CC=CC=C2C(=N1)CCl)C |
Computed by PubChem (NCBI)