CAS 40280-57-7 is the registry number for 1-(Naphthalen-1-yl)ethanamine hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-naphthalen-1-ylethanamine;hydrochloride (CAS 40280-57-7) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: ZTNKTVBJMXQOBQ-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | ZTNKTVBJMXQOBQ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)