CAS 2017-67-6 appears in our catalog under these names: 2-(2-Naphthyl)ethanamine hydrochloride, 95%, 2-(2-Naphthyl)ethanamine hydrochloride, [2-(2-naphthyl)ethyl]amine hydrochloride, ≥97%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g.
2-naphthalen-2-ylethanamine;hydrochloride (CAS 2017-67-6) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: 2-naphthalen-2-ylethanamine;hydrochloride. InChIKey: VJPPXKBLHHCXLG-UHFFFAOYSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | 2-naphthalen-2-ylethanamine;hydrochloride |
| InChIKey | VJPPXKBLHHCXLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CCN.Cl |
Computed by PubChem (NCBI)