CAS 51600-24-9 appears in our catalog under these names: (S)-(-)-1-(1-Naphthyl)ethylamine hydrochloride, 96%, (S)-1-(Naphthalen-1-yl)ethanamine hydrochloride 96%, (S)-1-(Naphthalen-1-yl)ethanamine hydrochloride, 96%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g.
(1S)-1-naphthalen-1-ylethanamine;hydrochloride (CAS 51600-24-9) is a chemical compound with the molecular formula C12H14ClN and a molecular weight of 207.70 g/mol. IUPAC name: (1S)-1-naphthalen-1-ylethanamine;hydrochloride. InChIKey: ZTNKTVBJMXQOBQ-FVGYRXGTSA-N.
| Molecular formula | C12H14ClN |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | (1S)-1-naphthalen-1-ylethanamine;hydrochloride |
| InChIKey | ZTNKTVBJMXQOBQ-FVGYRXGTSA-N |
| SMILES | C[C@@H](C1=CC=CC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)