6-Chloro-2,9-dimethyl-9H-purine, 97%
cas: 40423-36-7 — see every product listed under this CAS number, including other names
6-Chloro-2,9-dimethyl-9H-purine, 97% (CAS 40423-36-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A412835-100mg |
| cas | 40423-36-7 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 2623.19 Pln | |
| Ambeed | 250mg | 4024.94 Pln | |
| Ambeed | 1g | 12719.12 Pln | |
| Chemat | 50mg | 1235.60 Pln | |
| Chemat | 100mg | 2056.40 Pln | |
| Chemat | 250mg | 3448.40 Pln | |
| Chemat | 1g | 10898.00 Pln | |
| BLDpharm | 50mg | 1608.35 Pln | |
| BLDpharm | 100mg | 2569.12 Pln | |
| BLDpharm | 250mg | 4518.43 Pln | |
| BLDpharm | 1g | 14314.98 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
6-chloro-2,9-dimethylpurine (CAS 40423-36-7) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 6-chloro-2,9-dimethylpurine. InChIKey: SKTPMBONYIWPAC-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 6-chloro-2,9-dimethylpurine |
| InChIKey | SKTPMBONYIWPAC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)Cl)N=CN2C |
Computed by PubChem (NCBI)