CAS 1248709-15-0 appears in our catalog under these names: 4-Chloro-1-ethyl-1h-pyrazolo[3,4-d]pyrimidine, 95%, 4-Chloro-1-ethyl-1H-pyrazolo(3,4-d)pyrimidine, 95+%, 4-Chloro-1-ethyl-1H-pyrazolo(3,4-d)pyrimidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
4-chloro-1-ethylpyrazolo[5,4-d]pyrimidine (CAS 1248709-15-0) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 4-chloro-1-ethylpyrazolo[5,4-d]pyrimidine. InChIKey: PKYBLHLCAXANOJ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 4-chloro-1-ethylpyrazolo[5,4-d]pyrimidine |
| InChIKey | PKYBLHLCAXANOJ-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=N1)C(=NC=N2)Cl |
Computed by PubChem (NCBI)