CAS 87412-89-3 is the registry number for 4-Chloro-1,3-dimethyl-1h-pyrazolo[3,4-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-chloro-1,3-dimethylpyrazolo[5,4-d]pyrimidine (CAS 87412-89-3) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 4-chloro-1,3-dimethylpyrazolo[5,4-d]pyrimidine. InChIKey: RKCUSLQIKDPCGC-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 4-chloro-1,3-dimethylpyrazolo[5,4-d]pyrimidine |
| InChIKey | RKCUSLQIKDPCGC-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1C(=NC=N2)Cl)C |
Computed by PubChem (NCBI)