Products 1363405-82-6
CAS 1363405-82-6 appears in our catalog under these names: 4-Chloro-1-methyl-1h-pyrazolo[3,4-b]pyridin-5-amine, 95%, 4-Chloro-1-methyl-1H-pyrazolo(3,4-b)pyridin-5-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
4-chloro-1-methylpyrazolo[3,4-b]pyridin-5-amine (CAS 1363405-82-6) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 4-chloro-1-methylpyrazolo[3,4-b]pyridin-5-amine. InChIKey: PLUIIJDTIZGZEK-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 4-chloro-1-methylpyrazolo[3,4-b]pyridin-5-amine |
| InChIKey | PLUIIJDTIZGZEK-UHFFFAOYSA-N |
| SMILES | CN1C2=NC=C(C(=C2C=N1)Cl)N |
Computed by PubChem (NCBI)