CAS 1313712-48-9 is the registry number for 8-Chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
8-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1313712-48-9) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 8-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: GPWFIOYGGIXBSZ-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 8-chloro-6-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | GPWFIOYGGIXBSZ-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=NC(=N2)N)C(=C1)Cl |
Computed by PubChem (NCBI)