Products 934047-83-3
CAS 934047-83-3 appears in our catalog under these names: 1,3-Bis(cyanomethyl)imidazolium chloride, 95%, 1,3–Bis(cyanomethyl)imidazolium chloride, 1,3-Bis(cyanomethyl)imidazolium chloride, 1，3-Bis(cyanomethyl)imidazolium chloride, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg.
2-[3-(cyanomethyl)imidazol-3-ium-1-yl]acetonitrile chloride (CAS 934047-83-3) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 2-[3-(cyanomethyl)imidazol-3-ium-1-yl]acetonitrile chloride. InChIKey: PZSHHOPVYJHGQL-UHFFFAOYSA-M.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 2-[3-(cyanomethyl)imidazol-3-ium-1-yl]acetonitrile chloride |
| InChIKey | PZSHHOPVYJHGQL-UHFFFAOYSA-M |
| SMILES | C1=C[N+](=CN1CC#N)CC#N.[Cl-] |
Computed by PubChem (NCBI)