CAS 89793-29-3 appears in our catalog under these names: 7-Chloro-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine, 95%, 7-Chloro-5,6-dimethyl-(1,2,4)triazolo(1,5-a)pyrimidine, 97%, 7-Chloro-5,6-dimethyl-(1,2,4)triazolo(1,5-a)pyrimidine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 10g, 1g, 0,5g, 50mg.
7-chloro-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (CAS 89793-29-3) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 7-chloro-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine. InChIKey: RPHBQCUEWQSJTD-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 7-chloro-5,6-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| InChIKey | RPHBQCUEWQSJTD-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=NC=N2)N=C1C)Cl |
Computed by PubChem (NCBI)