cas: 343852-44-8 — see every product listed under this CAS number, including other names
6-Chloro-2-methyl-2,3-dihydro-1H-inden-1-one, 98% (CAS 343852-44-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F231663-250MG |
| cas | 343852-44-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 325.94 Pln | |
| Fluorochem | 1g | 690.40 Pln | |
| Fluorochem | 5g | 2294.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-chloro-2-methyl-2,3-dihydroinden-1-one (CAS 343852-44-8) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 6-chloro-2-methyl-2,3-dihydroinden-1-one. InChIKey: GVWWIBFTRLTHMY-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 6-chloro-2-methyl-2,3-dihydroinden-1-one |
| InChIKey | GVWWIBFTRLTHMY-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)