cas: 114858-39-8 — see every product listed under this CAS number, including other names
6-Chloro-2-methylquinoline-3-carboxylic acid ethyl ester, 96%, 96% (CAS 114858-39-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FC4-100mg |
| cas | 114858-39-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 1g | 1019.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Ethyl 6-chloro-2-methylquinoline-3-carboxylate (CAS 114858-39-8) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: ethyl 6-chloro-2-methylquinoline-3-carboxylate. InChIKey: KZZFZNSEHULNFN-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | ethyl 6-chloro-2-methylquinoline-3-carboxylate |
| InChIKey | KZZFZNSEHULNFN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=CC(=CC2=C1)Cl)C |
Computed by PubChem (NCBI)