cas: 114858-39-8 — see every product listed under this CAS number, including other names
Ethyl 6-chloro-2-methyl-3-quinolinecarboxylate, 95-<97% (CAS 114858-39-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC452-95-97-10g |
| cas | 114858-39-8 |
| size | 10g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 10g | 4971.78 Pln | |
| Hoffman Fine Chemicals | 25g | 8519.06 Pln | |
| Hoffman Fine Chemicals | 50g | 13444.42 Pln | |
| Hoffman Fine Chemicals | 100g | 21330.10 Pln | |
| Hoffman Fine Chemicals | 200g | 36048.76 Pln | |
| Hoffman Fine Chemicals | 300g | 45880.34 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
Ethyl 6-chloro-2-methylquinoline-3-carboxylate (CAS 114858-39-8) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: ethyl 6-chloro-2-methylquinoline-3-carboxylate. InChIKey: KZZFZNSEHULNFN-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | ethyl 6-chloro-2-methylquinoline-3-carboxylate |
| InChIKey | KZZFZNSEHULNFN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C2C=CC(=CC2=C1)Cl)C |
Computed by PubChem (NCBI)