6-Chloro-7-fluoroindoline-2,3-dione, 97%
cas: 942493-23-4 — see every product listed under this CAS number, including other names
6-Chloro-7-fluoroindoline-2,3-dione, 97% (CAS 942493-23-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F232192-250MG |
| cas | 942493-23-4 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 695.61 Pln | |
| Fluorochem | 5g | 2668.87 Pln | |
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 676.31 Pln | |
| Ambeed | 5g | 2589.81 Pln | |
| BLDpharm | 250mg | 414.32 Pln | |
| BLDpharm | 1g | 725.32 Pln | |
| BLDpharm | 5g | 2785.71 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 500mg | 338.00 Pln | |
| Chemat | 1g | 563.60 Pln | |
| Chemat | 5g | 1816.40 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
6-chloro-7-fluoro-1H-indole-2,3-dione (CAS 942493-23-4) is a chemical compound with the molecular formula C8H3ClFNO2 and a molecular weight of 199.56 g/mol. IUPAC name: 6-chloro-7-fluoro-1H-indole-2,3-dione. InChIKey: KPIXRLPJNJURAJ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO2 |
|---|---|
| Molecular weight | 199.56 g/mol |
| IUPAC name | 6-chloro-7-fluoro-1H-indole-2,3-dione |
| InChIKey | KPIXRLPJNJURAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C(=O)C(=O)N2)F)Cl |
Computed by PubChem (NCBI)