CAS 96202-57-2 appears in our catalog under these names: 5–Fluoro–6–chloroisatin, 5-Fluoro-6-chloroisatin 98%, 5-Fluoro-6-chloroisatin, 98%, 98%, 5-Fluoro-6-chloroisatin, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
6-chloro-5-fluoro-1H-indole-2,3-dione (CAS 96202-57-2) is a chemical compound with the molecular formula C8H3ClFNO2 and a molecular weight of 199.56 g/mol. IUPAC name: 6-chloro-5-fluoro-1H-indole-2,3-dione. InChIKey: GHBWNCFDSGAFIT-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO2 |
|---|---|
| Molecular weight | 199.56 g/mol |
| IUPAC name | 6-chloro-5-fluoro-1H-indole-2,3-dione |
| InChIKey | GHBWNCFDSGAFIT-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Cl)NC(=O)C2=O |
Computed by PubChem (NCBI)