CAS 954252-18-7 appears in our catalog under these names: 4-Chloro-7-fluoroindoline-2,3-dione, 98%, 4-Chloro-7-fluoro-1h-indole-2,3-dione, 95%, 4-Chloro-7-fluoro-1h-indole-2,3-dione, 98%, 98%, 4-Chloro-7-fluoro-2,3-dihydro-1h-indole-2,3-dione, 98%. Offered by: AmBeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 100mg, 10g, 1g, 50mg, 500mg, 2.5g.
4-chloro-7-fluoro-1H-indole-2,3-dione (CAS 954252-18-7) is a chemical compound with the molecular formula C8H3ClFNO2 and a molecular weight of 199.56 g/mol. IUPAC name: 4-chloro-7-fluoro-1H-indole-2,3-dione. InChIKey: JGPDIMCZEPIIMI-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO2 |
|---|---|
| Molecular weight | 199.56 g/mol |
| IUPAC name | 4-chloro-7-fluoro-1H-indole-2,3-dione |
| InChIKey | JGPDIMCZEPIIMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1F)NC(=O)C2=O)Cl |
Computed by PubChem (NCBI)