Products 1628684-15-0
CAS 1628684-15-0 appears in our catalog under these names: 4-Chloro-3-cyano-2-fluorobenzoicAcid, ≥97%, ≥97%, 4-CHLORO-3-CYANO-2-FLUOROBENZOIC ACID, ≥97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 5g, 10g.
4-chloro-3-cyano-2-fluorobenzoic acid (CAS 1628684-15-0) is a chemical compound with the molecular formula C8H3ClFNO2 and a molecular weight of 199.56 g/mol. IUPAC name: 4-chloro-3-cyano-2-fluorobenzoic acid. InChIKey: HCIDUHQPCWSXOZ-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO2 |
|---|---|
| Molecular weight | 199.56 g/mol |
| IUPAC name | 4-chloro-3-cyano-2-fluorobenzoic acid |
| InChIKey | HCIDUHQPCWSXOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)C#N)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-chloro-3-cyano-2-fluoro-benzoic acid