CAS 259860-03-2 appears in our catalog under these names: 7–Chloro–5–fluoroindoline–2,3–dione, 7-Chloro-5-fluoroindoline-2,3-dione, 7-Chloro-5-fluoro-1H-indole-2,3-dione, 95%, 95%, 7-Chloro-5-fluoroindoline-2,3-dione, 95%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
7-chloro-5-fluoro-1H-indole-2,3-dione (CAS 259860-03-2) is a chemical compound with the molecular formula C8H3ClFNO2 and a molecular weight of 199.56 g/mol. IUPAC name: 7-chloro-5-fluoro-1H-indole-2,3-dione. InChIKey: CRNNFZRMOHSUJH-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO2 |
|---|---|
| Molecular weight | 199.56 g/mol |
| IUPAC name | 7-chloro-5-fluoro-1H-indole-2,3-dione |
| InChIKey | CRNNFZRMOHSUJH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C(=O)N2)Cl)F |
Computed by PubChem (NCBI)