CAS 953897-06-8 appears in our catalog under these names: 5-Chloro-6-fluoro-2,3-dihydro-1h-indole-2,3-dione, 95%, 5-Chloro-6-fluoroisatin, 6-Fluoro-5-chloroisatin, 95%. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 2,5g.
5-chloro-6-fluoro-1H-indole-2,3-dione (CAS 953897-06-8) is a chemical compound with the molecular formula C8H3ClFNO2 and a molecular weight of 199.56 g/mol. IUPAC name: 5-chloro-6-fluoro-1H-indole-2,3-dione. InChIKey: GLZQDDOVGRLCHY-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO2 |
|---|---|
| Molecular weight | 199.56 g/mol |
| IUPAC name | 5-chloro-6-fluoro-1H-indole-2,3-dione |
| InChIKey | GLZQDDOVGRLCHY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)F)NC(=O)C2=O |
Computed by PubChem (NCBI)