CAS 940054-45-5 appears in our catalog under these names: 4-Chloro-6-fluoro-1h-indole-2,3-dione, 90%, 4–Chloro–6–fluoroindoline–2,3–dione, 4-Chloro-6-fluoro-1H-indole-2,3-dione, 4-Chloro-6-fluoroindoline-2,3-dione, 97%, 97%, 4-CHLORO-6-FLUOROINDOLINE-2,3-DIONE, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 0,5g, 100mg.
4-chloro-6-fluoro-1H-indole-2,3-dione (CAS 940054-45-5) is a chemical compound with the molecular formula C8H3ClFNO2 and a molecular weight of 199.56 g/mol. IUPAC name: 4-chloro-6-fluoro-1H-indole-2,3-dione. InChIKey: VXDPVOKLIGCRAN-UHFFFAOYSA-N.
| Molecular formula | C8H3ClFNO2 |
|---|---|
| Molecular weight | 199.56 g/mol |
| IUPAC name | 4-chloro-6-fluoro-1H-indole-2,3-dione |
| InChIKey | VXDPVOKLIGCRAN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)C2=O)Cl)F |
Computed by PubChem (NCBI)