cas: 1248309-44-5 — see every product listed under this CAS number, including other names
6-Chloro-N-(1,1-dimethylethyl)-2-pyridinecarboxamide, 97%, 97% (CAS 1248309-44-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch134ZLB-100mg |
| cas | 1248309-44-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 213.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 1g | 573.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-tert-butyl-6-chloropyridine-2-carboxamide (CAS 1248309-44-5) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: N-tert-butyl-6-chloropyridine-2-carboxamide. InChIKey: XUKHLNSMACASMM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | N-tert-butyl-6-chloropyridine-2-carboxamide |
| InChIKey | XUKHLNSMACASMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC(=O)C1=NC(=CC=C1)Cl |
Computed by PubChem (NCBI)