CAS 94783-18-3 appears in our catalog under these names: 1-Phenylpiperazin-2-one hydrochloride, 95%, 1-Phenylpiperazin-2-one hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 25g, 1g, 0,5g.
1-phenylpiperazin-2-one;hydrochloride (CAS 94783-18-3) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: 1-phenylpiperazin-2-one;hydrochloride. InChIKey: GIMLKUOVPYUIBV-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | 1-phenylpiperazin-2-one;hydrochloride |
| InChIKey | GIMLKUOVPYUIBV-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)CN1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)