CAS 188577-70-0 appears in our catalog under these names: N-(4-Chloro-pyridin-2-yl)-2,2-dimethyl-propionamide, 95%, N-(4-Chloropyridin-2-yl)pivalamide, 97%, N-(4-CHLORO-PYRIDIN-2-YL)-2,2-DIMETHYL-PROPIONAMIDE, 99%, 99%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100mg, 500mg.
N-(4-chloro-2-pyridinyl)-2,2-dimethylpropanamide (CAS 188577-70-0) is a chemical compound with the molecular formula C10H13ClN2O and a molecular weight of 212.67 g/mol. IUPAC name: N-(4-chloro-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: HDLIWEMWMDOCHM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O |
|---|---|
| Molecular weight | 212.67 g/mol |
| IUPAC name | N-(4-chloro-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | HDLIWEMWMDOCHM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=CC(=C1)Cl |
Computed by PubChem (NCBI)