6-Chloropyridine-2,3-dicarboxylic acid, 96%
cas: 127437-44-9 — see every product listed under this CAS number, including other names
6-Chloropyridine-2,3-dicarboxylic acid, 96% (CAS 127437-44-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F634134-100MG |
| cas | 127437-44-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 419.66 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1440.14 Pln | |
| Fluorochem | 5g | 3423.81 Pln | |
| Fluorochem | 10g | 5631.37 Pln | |
| Fluorochem | 25g | 9968.38 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
6-chloropyridine-2,3-dicarboxylic acid (CAS 127437-44-9) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 6-chloropyridine-2,3-dicarboxylic acid. InChIKey: UZSYXDLIFFSYNQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 6-chloropyridine-2,3-dicarboxylic acid |
| InChIKey | UZSYXDLIFFSYNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)