cas: 127437-44-9 — see every product listed under this CAS number, including other names
6-Chloropyridine-2,3-dicarboxylic acid, 97%, 97% (CAS 127437-44-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111X3C-100mg |
| cas | 127437-44-9 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 314.00 Pln | |
| Chemat | 250mg | 486.80 Pln | |
| Chemat | 1g | 1019.60 Pln | |
| Chemat | 5g | 2454.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-chloropyridine-2,3-dicarboxylic acid (CAS 127437-44-9) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 6-chloropyridine-2,3-dicarboxylic acid. InChIKey: UZSYXDLIFFSYNQ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 6-chloropyridine-2,3-dicarboxylic acid |
| InChIKey | UZSYXDLIFFSYNQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1C(=O)O)C(=O)O)Cl |
Computed by PubChem (NCBI)