cas: 2173991-58-5 — see every product listed under this CAS number, including other names
6-Chlorospiro[indoline-3,3'-pyrrolidin]-2-onehydrochloride, 97% (CAS 2173991-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F691346-100MG |
| cas | 2173991-58-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 3652.90 Pln | |
| Fluorochem | 250mg | 5787.56 Pln | |
| Fluorochem | 500mg | 9598.72 Pln | |
| Fluorochem | 1g | 14347.05 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-chlorospiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride (CAS 2173991-58-5) is a chemical compound with the molecular formula C11H12Cl2N2O and a molecular weight of 259.13 g/mol. IUPAC name: 6-chlorospiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride. InChIKey: AOGIWYBEMKMTDP-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O |
|---|---|
| Molecular weight | 259.13 g/mol |
| IUPAC name | 6-chlorospiro[1H-indole-3,3'-pyrrolidine]-2-one;hydrochloride |
| InChIKey | AOGIWYBEMKMTDP-UHFFFAOYSA-N |
| SMILES | C1CNCC12C3=C(C=C(C=C3)Cl)NC2=O.Cl |
Computed by PubChem (NCBI)