6-Cyanopyridine-2-sulfonyl chloride, 95%
cas: 1343041-93-9 — see every product listed under this CAS number, including other names
6-Cyanopyridine-2-sulfonyl chloride, 95% (CAS 1343041-93-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F781547-100MG |
| cas | 1343041-93-9 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1185.02 Pln | |
| Fluorochem | 250mg | 1716.08 Pln | |
| Ambeed | 250mg | 1282.62 Pln | |
| Ambeed | 1g | 2806.75 Pln | |
| Ambeed | 5g | 11000.31 Pln | |
| Chemat | 50mg | 606.80 Pln | |
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 1197.20 Pln | |
| Chemat | 1g | 2901.20 Pln | |
| Chemat | 5g | 11406.80 Pln | |
| BLDpharm | 50mg | 708.66 Pln | |
| BLDpharm | 100mg | 936.36 Pln | |
| BLDpharm | 250mg | 1375.10 Pln | |
| BLDpharm | 1g | 3018.96 Pln | |
| BLDpharm | 5g | 11860.29 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
6-cyanopyridine-2-sulfonyl chloride (CAS 1343041-93-9) is a chemical compound with the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. IUPAC name: 6-cyanopyridine-2-sulfonyl chloride. InChIKey: MYMMVLIOCVILFV-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O2S |
|---|---|
| Molecular weight | 202.62 g/mol |
| IUPAC name | 6-cyanopyridine-2-sulfonyl chloride |
| InChIKey | MYMMVLIOCVILFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)