Products 1343041-93-9
CAS 1343041-93-9 appears in our catalog under these names: 6-Cyanopyridine-2-sulfonyl chloride 95%, 6-Cyanopyridine-2-sulfonyl chloride, 95%, 95%, 6-Cyanopyridine-2-sulfonyl chloride, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g.
6-cyanopyridine-2-sulfonyl chloride (CAS 1343041-93-9) is a chemical compound with the molecular formula C6H3ClN2O2S and a molecular weight of 202.62 g/mol. IUPAC name: 6-cyanopyridine-2-sulfonyl chloride. InChIKey: MYMMVLIOCVILFV-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O2S |
|---|---|
| Molecular weight | 202.62 g/mol |
| IUPAC name | 6-cyanopyridine-2-sulfonyl chloride |
| InChIKey | MYMMVLIOCVILFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)S(=O)(=O)Cl)C#N |
Computed by PubChem (NCBI)