cas: 875305-42-3 — see every product listed under this CAS number, including other names
6-FLUORO-1H-INDOLE-7-CARBOXYLIC ACID, 97% (CAS 875305-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F502041-100MG |
| cas | 875305-42-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 1096.51 Pln | |
| Fluorochem | 1g | 2809.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
6-fluoro-1H-indole-7-carboxylic acid (CAS 875305-42-3) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-1H-indole-7-carboxylic acid. InChIKey: YJYWCXSCEPWZIV-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-1H-indole-7-carboxylic acid |
| InChIKey | YJYWCXSCEPWZIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN2)C(=O)O)F |
Computed by PubChem (NCBI)