6-FLUORO-5-NITRO-1H-INDOLE, 98%
cas: 1609131-18-1 — see every product listed under this CAS number, including other names
6-FLUORO-5-NITRO-1H-INDOLE, 98% (CAS 1609131-18-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 25g, 250mg, 1g, 100mg, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F513416-500MG |
| cas | 1609131-18-1 |
| size | 500mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 851.80 Pln | |
| Fluorochem | 25g | 19824.29 Pln | |
| Ambeed | 250mg | 470.50 Pln | |
| Ambeed | 1g | 1176.94 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 746.00 Pln | |
| Chemat | 5g | 2824.40 Pln | |
| Chemat | 10g | 4917.20 Pln | |
| Chemat | 25g | 12074.00 Pln | |
| Fluorochem | 10g | 8958.32 Pln | |
| BLDpharm | 100mg | 375.45 Pln | |
| BLDpharm | 250mg | 503.18 Pln | |
| BLDpharm | 1g | 1264.02 Pln | |
| Fluorochem | 100mg | 404.04 Pln | |
| Fluorochem | 250mg | 633.13 Pln | |
| Fluorochem | 1g | 1382.86 Pln | |
| Fluorochem | 5g | 5235.67 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
6-fluoro-5-nitro-1H-indole (CAS 1609131-18-1) is a chemical compound with the molecular formula C8H5FN2O2 and a molecular weight of 180.14 g/mol. IUPAC name: 6-fluoro-5-nitro-1H-indole. InChIKey: ZTRIMPYGWOCLFT-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O2 |
|---|---|
| Molecular weight | 180.14 g/mol |
| IUPAC name | 6-fluoro-5-nitro-1H-indole |
| InChIKey | ZTRIMPYGWOCLFT-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)[N+](=O)[O-])F |
Computed by PubChem (NCBI)