6-Fluoro-1H-indole-7-carboxylic acid, 97%
cas: 875305-42-3 — see every product listed under this CAS number, including other names
6-Fluoro-1H-indole-7-carboxylic acid, 97% (CAS 875305-42-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A439277-250mg |
| cas | 875305-42-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2172.62 Pln | |
| Chemat | 100mg | 400.40 Pln | |
| Chemat | 250mg | 621.20 Pln | |
| Chemat | 500mg | 1149.20 Pln | |
| Chemat | 1g | 1557.20 Pln | |
| BLDpharm | 100mg | 575.38 Pln | |
| BLDpharm | 250mg | 914.15 Pln | |
| BLDpharm | 1g | 2335.87 Pln | |
| Fluorochem | 100mg | 726.85 Pln | |
| Fluorochem | 250mg | 1143.37 Pln | |
| Fluorochem | 1g | 2897.96 Pln | |
| Fluorochem | 500mg | 2122.19 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
6-fluoro-1H-indole-7-carboxylic acid (CAS 875305-42-3) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 6-fluoro-1H-indole-7-carboxylic acid. InChIKey: YJYWCXSCEPWZIV-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 6-fluoro-1H-indole-7-carboxylic acid |
| InChIKey | YJYWCXSCEPWZIV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1C=CN2)C(=O)O)F |
Computed by PubChem (NCBI)