cas: 88754-96-5 — see every product listed under this CAS number, including other names
6-Fluoro-2-methylchroman-4-one, 97%+(GC-MS),RG, 97%+(GC-MS),RG (CAS 88754-96-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114N8E-250mg |
| cas | 88754-96-5 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 5g | 150.80 Pln |
| purity | 97%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
6-fluoro-2-methyl-2,3-dihydrochromen-4-one (CAS 88754-96-5) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 6-fluoro-2-methyl-2,3-dihydrochromen-4-one. InChIKey: RPAIBTVEPAACRP-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 6-fluoro-2-methyl-2,3-dihydrochromen-4-one |
| InChIKey | RPAIBTVEPAACRP-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C(O1)C=CC(=C2)F |
Computed by PubChem (NCBI)