cas: 5043-00-5 — see every product listed under this CAS number, including other names
6-Fluoro-2-naphthoic acid methyl ester (CAS 5043-00-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F636388-250MG |
| cas | 5043-00-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 1731.70 Pln | |
| Fluorochem | 5g | 7453.64 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 6-fluoronaphthalene-2-carboxylate (CAS 5043-00-5) is a chemical compound with the molecular formula C12H9FO2 and a molecular weight of 204.20 g/mol. IUPAC name: methyl 6-fluoronaphthalene-2-carboxylate. InChIKey: FXLVPMMENJMZBM-UHFFFAOYSA-N.
| Molecular formula | C12H9FO2 |
|---|---|
| Molecular weight | 204.20 g/mol |
| IUPAC name | methyl 6-fluoronaphthalene-2-carboxylate |
| InChIKey | FXLVPMMENJMZBM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=C(C=C2)F |
Computed by PubChem (NCBI)