cas: 295779-82-7 — see every product listed under this CAS number, including other names
6-Fluoro-5-methoxy-2,3-dihydro-1H-inden-1-one, 98% (CAS 295779-82-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323850-100MG |
| cas | 295779-82-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 289.50 Pln | |
| Fluorochem | 250mg | 450.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
6-fluoro-5-methoxy-2,3-dihydroinden-1-one (CAS 295779-82-7) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 6-fluoro-5-methoxy-2,3-dihydroinden-1-one. InChIKey: UEAXBANALITWAP-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 6-fluoro-5-methoxy-2,3-dihydroinden-1-one |
| InChIKey | UEAXBANALITWAP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CCC2=O)F |
Computed by PubChem (NCBI)