cas: 223127-05-7 — see every product listed under this CAS number, including other names
6-Isopropoxynicotinic acid, 97%, 97% (CAS 223127-05-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118OVR-25mg |
| cas | 223127-05-7 |
| size | 25mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 88.40 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 1115.60 Pln | |
| Chemat | 500mg | 232.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
6-propan-2-yloxypyridine-3-carboxylic acid (CAS 223127-05-7) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 6-propan-2-yloxypyridine-3-carboxylic acid. InChIKey: OOIMOWCIYNEWCF-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 6-propan-2-yloxypyridine-3-carboxylic acid |
| InChIKey | OOIMOWCIYNEWCF-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)