cas: 62956-62-1 — see every product listed under this CAS number, including other names
6-Methoxy-2,3-dihydro-1H-indene-1-carboxylic acid 95% (CAS 62956-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1062703-100mg |
| cas | 62956-62-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 865.44 Pln | |
| Ambeed | 5g | 2673.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1062703 |
6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid (CAS 62956-62-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid. InChIKey: NYAXSJZIUOHLMW-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid |
| InChIKey | NYAXSJZIUOHLMW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCC2C(=O)O)C=C1 |
Computed by PubChem (NCBI)