cas: 62956-62-1 — see every product listed under this CAS number, including other names
6-Methoxy-2,3-dihydro-1h-indene-1-carboxylic acid, 95%, 95% (CAS 62956-62-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EL5X-100mg |
| cas | 62956-62-1 |
| size | 100mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 189.20 Pln | |
| Chemat | 250mg | 318.80 Pln | |
| Chemat | 500mg | 525.20 Pln | |
| Chemat | 1g | 784.40 Pln | |
| Chemat | 5g | 2877.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid (CAS 62956-62-1) is a chemical compound with the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. IUPAC name: 6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid. InChIKey: NYAXSJZIUOHLMW-UHFFFAOYSA-N.
| Molecular formula | C11H12O3 |
|---|---|
| Molecular weight | 192.21 g/mol |
| IUPAC name | 6-methoxy-2,3-dihydro-1H-indene-1-carboxylic acid |
| InChIKey | NYAXSJZIUOHLMW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CCC2C(=O)O)C=C1 |
Computed by PubChem (NCBI)