cas: 2472-22-2 — see every product listed under this CAS number, including other names
6-Methoxy-2-tetralone, 90% (CAS 2472-22-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 298920010 |
| cas | 2472-22-2 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 525.63 Pln | |
| Thermo Scientific (Acros) | 5g | 1786.23 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 90% |
6-methoxy-3,4-dihydro-1H-naphthalen-2-one (CAS 2472-22-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 6-methoxy-3,4-dihydro-1H-naphthalen-2-one. InChIKey: RMRKDYNVZWKAFP-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | RMRKDYNVZWKAFP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(=O)CC2)C=C1 |
Computed by PubChem (NCBI)