CAS 2472-22-2 appears in our catalog under these names: 6–Methoxy–2–tetralone, 6-Methoxy-2-tetralone, 95%, 6-Methoxy-2-tetralone, 90%, 6-Methoxy-2-tetralone, >95.0%(GC), 6-Methoxy-2-tetralone, 98%, 98%. Offered by: GLPBio, Combi-blocks, Thermo Scientific (Acros), TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
6-methoxy-3,4-dihydro-1H-naphthalen-2-one (CAS 2472-22-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 6-methoxy-3,4-dihydro-1H-naphthalen-2-one. InChIKey: RMRKDYNVZWKAFP-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 6-methoxy-3,4-dihydro-1H-naphthalen-2-one |
| InChIKey | RMRKDYNVZWKAFP-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(=O)CC2)C=C1 |
Computed by PubChem (NCBI)